C14H18ClF3O — CID 66048783
1-[2-(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]-3-methylbenzene (PubChem CID 66048783) has the molecular formula C14H18ClF3O and a molecular weight of 294.74 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]-3-methylbenzene.
| Compound Name | 1-[2-(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]-3-methylbenzene |
|---|---|
| PubChem CID | 66048783 |
| Molecular Formula | C14H18ClF3O |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[2-(chloromethyl)-4-(2,2,2-trifluoroethoxy)butyl]-3-methylbenzene |
| SMILES | Cc1cccc(CC(CCl)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3O/c1-11-3-2-4-12(7-11)8-13(9-15)5-6-19-10-14(16,17)18/h2-4,7,13H,5-6,8-10H2,1H3 |
| InChIKey | PQZGGNOSDKSBJU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|