C13H18BrClO — CID 66040719
1-[2-(bromomethyl)-5-methoxypentyl]-3-chlorobenzene (PubChem CID 66040719) has the molecular formula C13H18BrClO and a molecular weight of 305.64 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-methoxypentyl]-3-chlorobenzene.
| Compound Name | 1-[2-(bromomethyl)-5-methoxypentyl]-3-chlorobenzene |
|---|---|
| PubChem CID | 66040719 |
| Molecular Formula | C13H18BrClO |
| Molecular Weight | 305.64 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 1-[2-(bromomethyl)-5-methoxypentyl]-3-chlorobenzene |
| SMILES | COCCCC(CBr)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18BrClO/c1-16-7-3-5-12(10-14)8-11-4-2-6-13(15)9-11/h2,4,6,9,12H,3,5,7-8,10H2,1H3 |
| InChIKey | OQTPLAFIFFRJSU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|