C12H17ClO2 — CID 66057400
2-[(3-chlorophenyl)methyl]-4-methoxybutan-1-ol (PubChem CID 66057400) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-4-methoxybutan-1-ol.
| Compound Name | 2-[(3-chlorophenyl)methyl]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 66057400 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-4-methoxybutan-1-ol |
| SMILES | COCCC(CO)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClO2/c1-15-6-5-11(9-14)7-10-3-2-4-12(13)8-10/h2-4,8,11,14H,5-7,9H2,1H3 |
| InChIKey | UPFIURVBGWESRR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |