C17H27ClO — CID 66059498
2-[(3-chlorophenyl)methyl]-4-ethyloctan-1-ol (PubChem CID 66059498) has the molecular formula C17H27ClO and a molecular weight of 282.85 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-4-ethyloctan-1-ol.
| Compound Name | 2-[(3-chlorophenyl)methyl]-4-ethyloctan-1-ol |
|---|---|
| PubChem CID | 66059498 |
| Molecular Formula | C17H27ClO |
| Molecular Weight | 282.85 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-4-ethyloctan-1-ol |
| SMILES | CCCCC(CC)CC(CO)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H27ClO/c1-3-5-7-14(4-2)10-16(13-19)11-15-8-6-9-17(18)12-15/h6,8-9,12,14,16,19H,3-5,7,10-11,13H2,1-2H3 |
| InChIKey | ZIDDFCOPEACKLW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.85 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |