C17H26ClF — CID 66047696
1-[2-(chloromethyl)-4-ethyloctyl]-3-fluorobenzene (PubChem CID 66047696) has the molecular formula C17H26ClF and a molecular weight of 284.85 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-4-ethyloctyl]-3-fluorobenzene.
| Compound Name | 1-[2-(chloromethyl)-4-ethyloctyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 66047696 |
| Molecular Formula | C17H26ClF |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-[2-(chloromethyl)-4-ethyloctyl]-3-fluorobenzene |
| SMILES | CCCCC(CC)CC(CCl)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H26ClF/c1-3-5-7-14(4-2)10-16(13-18)11-15-8-6-9-17(19)12-15/h6,8-9,12,14,16H,3-5,7,10-11,13H2,1-2H3 |
| InChIKey | QNUVTVNZERZVQM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|