C15H24FN — CID 62529193
2-[(3-fluorophenyl)methyl]octan-1-amine (PubChem CID 62529193) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]octan-1-amine.
| Compound Name | 2-[(3-fluorophenyl)methyl]octan-1-amine |
|---|---|
| PubChem CID | 62529193 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]octan-1-amine |
| SMILES | CCCCCCC(CN)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H24FN/c1-2-3-4-5-7-14(12-17)10-13-8-6-9-15(16)11-13/h6,8-9,11,14H,2-5,7,10,12,17H2,1H3 |
| InChIKey | RIDUEEDDKVWOJO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|