C14H22BrN — CID 63495988
2-[(3-bromophenyl)methyl]heptan-1-amine (PubChem CID 63495988) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]heptan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]heptan-1-amine |
|---|---|
| PubChem CID | 63495988 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]heptan-1-amine |
| SMILES | CCCCCC(CN)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrN/c1-2-3-4-6-13(11-16)9-12-7-5-8-14(15)10-12/h5,7-8,10,13H,2-4,6,9,11,16H2,1H3 |
| InChIKey | SSNFAIGQBAHNPE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|