C17H28BrN — CID 63521929
2-[(3-bromophenyl)methyl]-N-propylheptan-1-amine (PubChem CID 63521929) has the molecular formula C17H28BrN and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-N-propylheptan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 63521929 |
| Molecular Formula | C17H28BrN |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-N-propylheptan-1-amine |
| SMILES | CCCCCC(CNCCC)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H28BrN/c1-3-5-6-8-16(14-19-11-4-2)12-15-9-7-10-17(18)13-15/h7,9-10,13,16,19H,3-6,8,11-12,14H2,1-2H3 |
| InChIKey | XWNYUTNWAIDPQX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|