C15H24BrN — CID 63523538
2-[(3-bromophenyl)methyl]-N-ethylhexan-1-amine (PubChem CID 63523538) has the molecular formula C15H24BrN and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-N-ethylhexan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-N-ethylhexan-1-amine |
|---|---|
| PubChem CID | 63523538 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-N-ethylhexan-1-amine |
| SMILES | CCCCC(CNCC)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C15H24BrN/c1-3-5-7-14(12-17-4-2)10-13-8-6-9-15(16)11-13/h6,8-9,11,14,17H,3-5,7,10,12H2,1-2H3 |
| InChIKey | POOZYFHVIRLUHK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |