C12H16ClF — CID 66034090
1-[2-(chloromethyl)pentyl]-3-fluorobenzene (PubChem CID 66034090) has the molecular formula C12H16ClF and a molecular weight of 214.71 g/mol. Its IUPAC name is 1-[2-(chloromethyl)pentyl]-3-fluorobenzene.
| Compound Name | 1-[2-(chloromethyl)pentyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 66034090 |
| Molecular Formula | C12H16ClF |
| Molecular Weight | 214.71 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-[2-(chloromethyl)pentyl]-3-fluorobenzene |
| SMILES | CCCC(CCl)Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H16ClF/c1-2-4-11(9-13)7-10-5-3-6-12(14)8-10/h3,5-6,8,11H,2,4,7,9H2,1H3 |
| InChIKey | VVBLEAQMKLLKNH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|