C17H17ClF2 — CID 105376010
2-[2-(chloromethyl)-3-(3-fluorophenyl)propyl]-4-fluoro-1-methylbenzene (PubChem CID 105376010) has the molecular formula C17H17ClF2 and a molecular weight of 294.77 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-(3-fluorophenyl)propyl]-4-fluoro-1-methylbenzene.
| Compound Name | 2-[2-(chloromethyl)-3-(3-fluorophenyl)propyl]-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 105376010 |
| Molecular Formula | C17H17ClF2 |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[2-(chloromethyl)-3-(3-fluorophenyl)propyl]-4-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(F)cc1CC(CCl)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H17ClF2/c1-12-5-6-17(20)10-15(12)8-14(11-18)7-13-3-2-4-16(19)9-13/h2-6,9-10,14H,7-8,11H2,1H3 |
| InChIKey | DHZNPTCYVWTWNO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|