C18H20ClFO — CID 105376013
2-[2-(chloromethyl)-3-(3-methoxyphenyl)propyl]-4-fluoro-1-methylbenzene (PubChem CID 105376013) has the molecular formula C18H20ClFO and a molecular weight of 306.81 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-(3-methoxyphenyl)propyl]-4-fluoro-1-methylbenzene.
| Compound Name | 2-[2-(chloromethyl)-3-(3-methoxyphenyl)propyl]-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 105376013 |
| Molecular Formula | C18H20ClFO |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[2-(chloromethyl)-3-(3-methoxyphenyl)propyl]-4-fluoro-1-methylbenzene |
| SMILES | COc1cccc(CC(CCl)Cc2cc(F)ccc2C)c1 |
| InChI | InChI=1S/C18H20ClFO/c1-13-6-7-17(20)11-16(13)9-15(12-19)8-14-4-3-5-18(10-14)21-2/h3-7,10-11,15H,8-9,12H2,1-2H3 |
| InChIKey | SVJIADHXDOUQCF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|