C14H20ClFO — CID 66049005
1-[2-(chloromethyl)-5-ethoxypentyl]-3-fluorobenzene (PubChem CID 66049005) has the molecular formula C14H20ClFO and a molecular weight of 258.76 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-5-ethoxypentyl]-3-fluorobenzene.
| Compound Name | 1-[2-(chloromethyl)-5-ethoxypentyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 66049005 |
| Molecular Formula | C14H20ClFO |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[2-(chloromethyl)-5-ethoxypentyl]-3-fluorobenzene |
| SMILES | CCOCCCC(CCl)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H20ClFO/c1-2-17-8-4-6-13(11-15)9-12-5-3-7-14(16)10-12/h3,5,7,10,13H,2,4,6,8-9,11H2,1H3 |
| InChIKey | UGHQPUICQNJRTQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|