C12H15ClF2 — CID 82934974
4-[2-(chloromethyl)pentyl]-1,2-difluorobenzene (PubChem CID 82934974) has the molecular formula C12H15ClF2 and a molecular weight of 232.70 g/mol. Its IUPAC name is 4-[2-(chloromethyl)pentyl]-1,2-difluorobenzene.
| Compound Name | 4-[2-(chloromethyl)pentyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 82934974 |
| Molecular Formula | C12H15ClF2 |
| Molecular Weight | 232.70 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-[2-(chloromethyl)pentyl]-1,2-difluorobenzene |
| SMILES | CCCC(CCl)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15ClF2/c1-2-3-10(8-13)6-9-4-5-11(14)12(15)7-9/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | NSVQHQVZPZISPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|