C12H16F2 — CID 143267689
1,2-difluoro-4-(2-methylpentyl)benzene (PubChem CID 143267689) has the molecular formula C12H16F2 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1,2-difluoro-4-(2-methylpentyl)benzene.
| Compound Name | 1,2-difluoro-4-(2-methylpentyl)benzene |
|---|---|
| PubChem CID | 143267689 |
| Molecular Formula | C12H16F2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,2-difluoro-4-(2-methylpentyl)benzene |
| SMILES | CCCC(C)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2/c1-3-4-9(2)7-10-5-6-11(13)12(14)8-10/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | OUDKVWSCFARABV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |