C11H15F2N — CID 24936146
1-(3,4-difluorophenyl)-N-ethylpropan-2-amine (PubChem CID 24936146) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-ethylpropan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 24936146 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-ethylpropan-2-amine |
| SMILES | CCNC(C)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H15F2N/c1-3-14-8(2)6-9-4-5-10(12)11(13)7-9/h4-5,7-8,14H,3,6H2,1-2H3 |
| InChIKey | YMPOYJBETDMIAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |