C22H29F2N — CID 165377963
N-[3-(4-tert-butylphenyl)propyl]-1-(3,4-difluorophenyl)propan-2-amine (PubChem CID 165377963) has the molecular formula C22H29F2N and a molecular weight of 345.48 g/mol. Its IUPAC name is N-[3-(4-tert-butylphenyl)propyl]-1-(3,4-difluorophenyl)propan-2-amine.
| Compound Name | N-[3-(4-tert-butylphenyl)propyl]-1-(3,4-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 165377963 |
| Molecular Formula | C22H29F2N |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-[3-(4-tert-butylphenyl)propyl]-1-(3,4-difluorophenyl)propan-2-amine |
| SMILES | CC(Cc1ccc(F)c(F)c1)NCCCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29F2N/c1-16(14-18-9-12-20(23)21(24)15-18)25-13-5-6-17-7-10-19(11-8-17)22(2,3)4/h7-12,15-16,25H,5-6,13-14H2,1-4H3 |
| InChIKey | OAMMCUZOCAWQHL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|