C20H24F2N2O — CID 167564412
2-fluoro-4-[3-[1-(3-fluoro-4-methylphenyl)propan-2-ylamino]propyl]benzamide (PubChem CID 167564412) has the molecular formula C20H24F2N2O and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-fluoro-4-[3-[1-(3-fluoro-4-methylphenyl)propan-2-ylamino]propyl]benzamide.
| Compound Name | 2-fluoro-4-[3-[1-(3-fluoro-4-methylphenyl)propan-2-ylamino]propyl]benzamide |
|---|---|
| PubChem CID | 167564412 |
| Molecular Formula | C20H24F2N2O |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-fluoro-4-[3-[1-(3-fluoro-4-methylphenyl)propan-2-ylamino]propyl]benzamide |
| SMILES | Cc1ccc(CC(C)NCCCc2ccc(C(N)=O)c(F)c2)cc1F |
| InChI | InChI=1S/C20H24F2N2O/c1-13-5-6-16(12-18(13)21)10-14(2)24-9-3-4-15-7-8-17(20(23)25)19(22)11-15/h5-8,11-12,14,24H,3-4,9-10H2,1-2H3,(H2,23,25) |
| InChIKey | JHFVYUXPSRJUBJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|