C14H22FN3O — CID 165405492
4-[(3S)-4-amino-3-(dimethylamino)-2-methylbutyl]-2-fluorobenzamide (PubChem CID 165405492) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-[(3S)-4-amino-3-(dimethylamino)-2-methylbutyl]-2-fluorobenzamide.
| Compound Name | 4-[(3S)-4-amino-3-(dimethylamino)-2-methylbutyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 165405492 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-[(3S)-4-amino-3-(dimethylamino)-2-methylbutyl]-2-fluorobenzamide |
| SMILES | CC(Cc1ccc(C(N)=O)c(F)c1)[C@@H](CN)N(C)C |
| InChI | InChI=1S/C14H22FN3O/c1-9(13(8-16)18(2)3)6-10-4-5-11(14(17)19)12(15)7-10/h4-5,7,9,13H,6,8,16H2,1-3H3,(H2,17,19)/t9?,13-/m1/s1 |
| InChIKey | SEMLEMGDZBZIIF-WCRCJTMVSA-N |
| XLogP | 0.99 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |