C11H17FN2O — CID 83442489
1-amino-3-[4-(dimethylamino)-3-fluorophenyl]propan-2-ol (PubChem CID 83442489) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-amino-3-[4-(dimethylamino)-3-fluorophenyl]propan-2-ol.
| Compound Name | 1-amino-3-[4-(dimethylamino)-3-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 83442489 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-amino-3-[4-(dimethylamino)-3-fluorophenyl]propan-2-ol |
| SMILES | CN(C)c1ccc(CC(O)CN)cc1F |
| InChI | InChI=1S/C11H17FN2O/c1-14(2)11-4-3-8(6-10(11)12)5-9(15)7-13/h3-4,6,9,15H,5,7,13H2,1-2H3 |
| InChIKey | LVHRISOHZQNEPP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |