C12H18FNO2 — CID 79086997
1-(dimethylamino)-3-(3-fluoro-4-methoxyphenyl)propan-2-ol (PubChem CID 79086997) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(3-fluoro-4-methoxyphenyl)propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-(3-fluoro-4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 79086997 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(dimethylamino)-3-(3-fluoro-4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc(CC(O)CN(C)C)cc1F |
| InChI | InChI=1S/C12H18FNO2/c1-14(2)8-10(15)6-9-4-5-12(16-3)11(13)7-9/h4-5,7,10,15H,6,8H2,1-3H3 |
| InChIKey | YTGVMZKFXRIJPD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |