C12H15FO2 — CID 116659969
1-(3-fluoro-4-methoxyphenyl)pent-4-en-2-ol (PubChem CID 116659969) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)pent-4-en-2-ol.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 116659969 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)pent-4-en-2-ol |
| SMILES | C=CCC(O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C12H15FO2/c1-3-4-10(14)7-9-5-6-12(15-2)11(13)8-9/h3,5-6,8,10,14H,1,4,7H2,2H3 |
| InChIKey | IZMOFLKOJVPPGP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|