C11H16FN — CID 89112656
2-fluoro-N,N-dimethyl-4-propylaniline (PubChem CID 89112656) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-4-propylaniline.
| Compound Name | 2-fluoro-N,N-dimethyl-4-propylaniline |
|---|---|
| PubChem CID | 89112656 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-4-propylaniline |
| SMILES | CCCc1ccc(N(C)C)c(F)c1 |
| InChI | InChI=1S/C11H16FN/c1-4-5-9-6-7-11(13(2)3)10(12)8-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | TXNGZWRXIHCGFG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |