C9H12Cl2FN — CID 22072566
4-(chloromethyl)-2-fluoro-N,N-dimethylaniline;hydrochloride (PubChem CID 22072566) has the molecular formula C9H12Cl2FN and a molecular weight of 224.11 g/mol. Its IUPAC name is 4-(chloromethyl)-2-fluoro-N,N-dimethylaniline;hydrochloride.
| Compound Name | 4-(chloromethyl)-2-fluoro-N,N-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 22072566 |
| Molecular Formula | C9H12Cl2FN |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 4-(chloromethyl)-2-fluoro-N,N-dimethylaniline;hydrochloride |
| SMILES | CN(C)c1ccc(CCl)cc1F.Cl |
| InChI | InChI=1S/C9H11ClFN.ClH/c1-12(2)9-4-3-7(6-10)5-8(9)11;/h3-5H,6H2,1-2H3;1H |
| InChIKey | ZEHDDWXQBDGZCY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|