C16H15F2N — CID 51039205
4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline (PubChem CID 51039205) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 51039205 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H15F2N/c1-19(2)13-9-6-12(7-10-13)8-11-14-15(17)4-3-5-16(14)18/h3-11H,1-2H3/b11-8+ |
| InChIKey | YBJDCOLXJYDHOM-DHZHZOJOSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|