About N-benzyl-N-ethylaniline
N-benzyl-N-ethylaniline (PubChem CID 7098) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is N-benzyl-N-ethylaniline.
Molecular Properties
| Compound Name | N-benzyl-N-ethylaniline |
| PubChem CID | 7098 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-benzyl-N-ethylaniline |
| SMILES | CCN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17N/c1-2-16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3 |
| InChIKey | HSZCJVZRHXPCIA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-ethylaniline?
The IUPAC name of N-benzyl-N-ethylaniline (CID 7098) is N-benzyl-N-ethylaniline.
What is the SMILES notation for N-benzyl-N-ethylaniline?
The canonical SMILES for N-benzyl-N-ethylaniline is CCN(Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-N-ethylaniline?
The InChIKey is HSZCJVZRHXPCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N/c1-2-16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3.
What are the key properties of N-benzyl-N-ethylaniline?
N-benzyl-N-ethylaniline has a molecular weight of 211.31 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-ethylaniline is sourced from PubChem (CID 7098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).