About Dimethyl-p-toluidine
Dimethyl-p-toluidine (PubChem CID 7471) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is N,N,4-trimethylaniline.
Molecular Properties
| Compound Name | Dimethyl-p-toluidine |
| PubChem CID | 7471 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N,N,4-trimethylaniline |
| SMILES | CC1=CC=C(C=C1)N(C)C |
| InChI | InChI=1S/C9H13N/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1-3H3 |
| InChIKey | GYVGXEWAOAAJEU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 90 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze Dimethyl-p-toluidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dimethyl-p-toluidine?
The IUPAC name of Dimethyl-p-toluidine (CID 7471) is N,N,4-trimethylaniline.
What is the SMILES notation for Dimethyl-p-toluidine?
The canonical SMILES for Dimethyl-p-toluidine is CC1=CC=C(C=C1)N(C)C.
What is the InChIKey of Dimethyl-p-toluidine?
The InChIKey is GYVGXEWAOAAJEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1-3H3.
What are the key properties of Dimethyl-p-toluidine?
Dimethyl-p-toluidine has a molecular weight of 135.21 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Dimethyl-p-toluidine is sourced from PubChem (CID 7471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).