About 4-butylaniline
4-butylaniline (PubChem CID 7694) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 4-butylaniline.
Molecular Properties
| Compound Name | 4-butylaniline |
| PubChem CID | 7694 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4-butylaniline |
| SMILES | CCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3 |
| InChIKey | OGIQUQKNJJTLSZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-butylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylaniline?
The IUPAC name of 4-butylaniline (CID 7694) is 4-butylaniline.
What is the SMILES notation for 4-butylaniline?
The canonical SMILES for 4-butylaniline is CCCCc1ccc(N)cc1.
What is the InChIKey of 4-butylaniline?
The InChIKey is OGIQUQKNJJTLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3.
What are the key properties of 4-butylaniline?
4-butylaniline has a molecular weight of 149.24 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylaniline is sourced from PubChem (CID 7694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).