About o-Tolidine
o-Tolidine (PubChem CID 8413) has the molecular formula C14H16N2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-(4-amino-3-methylphenyl)-2-methylaniline.
Molecular Properties
| Compound Name | o-Tolidine |
| PubChem CID | 8413 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2-methylaniline |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
| InChI | InChI=1S/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 |
| InChIKey | NUIURNJTPRWVAP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | 205 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze o-Tolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of o-Tolidine?
The IUPAC name of o-Tolidine (CID 8413) is 4-(4-amino-3-methylphenyl)-2-methylaniline.
What is the SMILES notation for o-Tolidine?
The canonical SMILES for o-Tolidine is CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N.
What is the InChIKey of o-Tolidine?
The InChIKey is NUIURNJTPRWVAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3.
What are the key properties of o-Tolidine?
o-Tolidine has a molecular weight of 212.29 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for o-Tolidine is sourced from PubChem (CID 8413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).