About Magenta Base
Magenta Base (PubChem CID 12448) has the molecular formula C20H19N3
and a molecular weight of 301.40 g/mol. Its IUPAC name is 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline.
Molecular Properties
| Compound Name | Magenta Base |
| PubChem CID | 12448 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline |
| SMILES | CC1=CC(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C=CC1=N |
| InChI | InChI=1S/C20H19N3/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15/h2-12,23H,21-22H2,1H3 |
| InChIKey | YDCMWLQSPFTWCS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | 515 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze Magenta Base with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Magenta Base?
The IUPAC name of Magenta Base (CID 12448) is 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline.
What is the SMILES notation for Magenta Base?
The canonical SMILES for Magenta Base is CC1=CC(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C=CC1=N.
What is the InChIKey of Magenta Base?
The InChIKey is YDCMWLQSPFTWCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15/h2-12,23H,21-22H2,1H3.
What are the key properties of Magenta Base?
Magenta Base has a molecular weight of 301.40 g/mol, XLogP of 3.70, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Magenta Base is sourced from PubChem (CID 12448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).