About 4-ethylaniline
4-ethylaniline (PubChem CID 11504) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 4-ethylaniline.
Molecular Properties
| Compound Name | 4-ethylaniline |
| PubChem CID | 11504 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 4-ethylaniline |
| SMILES | CCc1ccc(N)cc1 |
| InChI | InChI=1S/C8H11N/c1-2-7-3-5-8(9)6-4-7/h3-6H,2,9H2,1H3 |
| InChIKey | HRXZRAXKKNUKRF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylaniline?
The IUPAC name of 4-ethylaniline (CID 11504) is 4-ethylaniline.
What is the SMILES notation for 4-ethylaniline?
The canonical SMILES for 4-ethylaniline is CCc1ccc(N)cc1.
What is the InChIKey of 4-ethylaniline?
The InChIKey is HRXZRAXKKNUKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-2-7-3-5-8(9)6-4-7/h3-6H,2,9H2,1H3.
What are the key properties of 4-ethylaniline?
4-ethylaniline has a molecular weight of 121.18 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylaniline is sourced from PubChem (CID 11504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).