C9H13N — CID 8488
N,N,3-trimethylaniline (PubChem CID 8488) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is N,N,3-trimethylaniline.
| Compound Name | N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 8488 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N,N,3-trimethylaniline |
| SMILES | Cc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C9H13N/c1-8-5-4-6-9(7-8)10(2)3/h4-7H,1-3H3 |
| InChIKey | CWOMTHDOJCARBY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |