C11H13FN2O4 — CID 175526236
[1-(4-carbamoyl-3-fluorophenyl)-3-hydroxypropan-2-yl] carbamate (PubChem CID 175526236) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is [1-(4-carbamoyl-3-fluorophenyl)-3-hydroxypropan-2-yl] carbamate.
| Compound Name | [1-(4-carbamoyl-3-fluorophenyl)-3-hydroxypropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175526236 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [1-(4-carbamoyl-3-fluorophenyl)-3-hydroxypropan-2-yl] carbamate |
| SMILES | NC(=O)OC(CO)Cc1ccc(C(N)=O)c(F)c1 |
| InChI | InChI=1S/C11H13FN2O4/c12-9-4-6(1-2-8(9)10(13)16)3-7(5-15)18-11(14)17/h1-2,4,7,15H,3,5H2,(H2,13,16)(H2,14,17) |
| InChIKey | MPHCOIXADNJNQA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |