C16H11FN2O3 — CID 22481659
4-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide (PubChem CID 22481659) has the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 22481659 |
| Molecular Formula | C16H11FN2O3 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C16H11FN2O3/c17-13-7-9(5-6-12(13)14(18)20)8-19-15(21)10-3-1-2-4-11(10)16(19)22/h1-7H,8H2,(H2,18,20) |
| InChIKey | YPYSGDOXJODEOW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|