C16H12FNO4S — CID 86711602
2-[(3-fluoro-4-methylsulfonylphenyl)methyl]isoindole-1,3-dione (PubChem CID 86711602) has the molecular formula C16H12FNO4S and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methylsulfonylphenyl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3-fluoro-4-methylsulfonylphenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86711602 |
| Molecular Formula | C16H12FNO4S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[(3-fluoro-4-methylsulfonylphenyl)methyl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C16H12FNO4S/c1-23(21,22)14-7-6-10(8-13(14)17)9-18-15(19)11-4-2-3-5-12(11)16(18)20/h2-8H,9H2,1H3 |
| InChIKey | AYPUEBKRPGRJQK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|