C15H11NO5 — CID 91971420
2-[(3,4,5-trihydroxyphenyl)methyl]isoindole-1,3-dione (PubChem CID 91971420) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-[(3,4,5-trihydroxyphenyl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3,4,5-trihydroxyphenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91971420 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[(3,4,5-trihydroxyphenyl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H11NO5/c17-11-5-8(6-12(18)13(11)19)7-16-14(20)9-3-1-2-4-10(9)15(16)21/h1-6,17-19H,7H2 |
| InChIKey | NZRDSXGXLGCZBO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|