C30H22N4O4 — CID 167064144
2-[[3-[2-[3-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]hydrazinyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 167064144) has the molecular formula C30H22N4O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[[3-[2-[3-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]hydrazinyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[2-[3-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]hydrazinyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167064144 |
| Molecular Formula | C30H22N4O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[[3-[2-[3-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]hydrazinyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cccc(NNc2cccc(CN3C(=O)c4ccccc4C3=O)c2)c1 |
| InChI | InChI=1S/C30H22N4O4/c35-27-23-11-1-2-12-24(23)28(36)33(27)17-19-7-5-9-21(15-19)31-32-22-10-6-8-20(16-22)18-34-29(37)25-13-3-4-14-26(25)30(34)38/h1-16,31-32H,17-18H2 |
| InChIKey | POMURSFERZXGOD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|