C24H15BrN2O4 — CID 15417918
2-[[3-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 15417918) has the molecular formula C24H15BrN2O4 and a molecular weight of 475.30 g/mol. Its IUPAC name is 2-[[3-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15417918 |
| Molecular Formula | C24H15BrN2O4 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 2-[[3-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(Br)cc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H15BrN2O4/c25-16-10-14(12-26-21(28)17-5-1-2-6-18(17)22(26)29)9-15(11-16)13-27-23(30)19-7-3-4-8-20(19)24(27)31/h1-11H,12-13H2 |
| InChIKey | NACSRSJCRNEZOB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|