C13H7Br2NO2S — CID 10692408
2-[(2,5-dibromothiophen-3-yl)methyl]isoindole-1,3-dione (PubChem CID 10692408) has the molecular formula C13H7Br2NO2S and a molecular weight of 401.08 g/mol. Its IUPAC name is 2-[(2,5-dibromothiophen-3-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2,5-dibromothiophen-3-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10692408 |
| Molecular Formula | C13H7Br2NO2S |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | 2-[(2,5-dibromothiophen-3-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(Br)sc1Br |
| InChI | InChI=1S/C13H7Br2NO2S/c14-10-5-7(11(15)19-10)6-16-12(17)8-3-1-2-4-9(8)13(16)18/h1-5H,6H2 |
| InChIKey | BEDRVMKVGXLRIV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|