C26H18N2O4 — CID 172539643
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-4-ethenylphenyl]methyl]isoindole-1,3-dione (PubChem CID 172539643) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-4-ethenylphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-4-ethenylphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172539643 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-4-ethenylphenyl]methyl]isoindole-1,3-dione |
| SMILES | C=Cc1ccc(CN2C(=O)c3ccccc3C2=O)c(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C26H18N2O4/c1-2-16-11-12-17(14-27-23(29)19-7-3-4-8-20(19)24(27)30)18(13-16)15-28-25(31)21-9-5-6-10-22(21)26(28)32/h2-13H,1,14-15H2 |
| InChIKey | UHOJKKPXVXAQRO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|