C28H24F3NO2 — CID 134225575
2-[[4-[(E)-3-(3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]methyl]isoindole-1,3-dione (PubChem CID 134225575) has the molecular formula C28H24F3NO2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(E)-3-(3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134225575 |
| Molecular Formula | C28H24F3NO2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-[[4-[(E)-3-(3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]methyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)cc(C(/C=C/c2ccc(CN3C(=O)c4ccccc4C3=O)c(C)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H24F3NO2/c1-17-12-18(2)14-22(13-17)25(28(29,30)31)11-9-20-8-10-21(19(3)15-20)16-32-26(33)23-6-4-5-7-24(23)27(32)34/h4-15,25H,16H2,1-3H3/b11-9+ |
| InChIKey | DEANWNNQBFMKII-PKNBQFBNSA-N |
| XLogP | 6.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|