C25H14Cl2F5NO2 — CID 123557007
2-[[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-fluorophenyl]methyl]isoindole-1,3-dione (PubChem CID 123557007) has the molecular formula C25H14Cl2F5NO2 and a molecular weight of 526.29 g/mol. Its IUPAC name is 2-[[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-fluorophenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-fluorophenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123557007 |
| Molecular Formula | C25H14Cl2F5NO2 |
| Molecular Weight | 526.29 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | 2-[[4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-fluorophenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(C=CC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1F |
| InChI | InChI=1S/C25H14Cl2F5NO2/c26-19-10-15(11-20(27)22(19)29)18(25(30,31)32)8-6-13-5-7-14(21(28)9-13)12-33-23(34)16-3-1-2-4-17(16)24(33)35/h1-11,18H,12H2 |
| InChIKey | VBWSZJLKHMSEAU-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.29 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|