C17H12Cl2F4S — CID 141407832
1,3-dichloro-2-fluoro-5-[(E)-1,1,1-trifluoro-4-(3-methylsulfanylphenyl)but-3-en-2-yl]benzene (PubChem CID 141407832) has the molecular formula C17H12Cl2F4S and a molecular weight of 395.25 g/mol. Its IUPAC name is 1,3-dichloro-2-fluoro-5-[(E)-1,1,1-trifluoro-4-(3-methylsulfanylphenyl)but-3-en-2-yl]benzene.
| Compound Name | 1,3-dichloro-2-fluoro-5-[(E)-1,1,1-trifluoro-4-(3-methylsulfanylphenyl)but-3-en-2-yl]benzene |
|---|---|
| PubChem CID | 141407832 |
| Molecular Formula | C17H12Cl2F4S |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 1,3-dichloro-2-fluoro-5-[(E)-1,1,1-trifluoro-4-(3-methylsulfanylphenyl)but-3-en-2-yl]benzene |
| SMILES | CSc1cccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12Cl2F4S/c1-24-12-4-2-3-10(7-12)5-6-13(17(21,22)23)11-8-14(18)16(20)15(19)9-11/h2-9,13H,1H3/b6-5+ |
| InChIKey | PQHRWDUBYBCHAA-AATRIKPKSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|