C20H14Cl2F4N2O — CID 123831405
2-amino-1-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]ethanone (PubChem CID 123831405) has the molecular formula C20H14Cl2F4N2O and a molecular weight of 445.24 g/mol. Its IUPAC name is 2-amino-1-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]ethanone.
| Compound Name | 2-amino-1-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 123831405 |
| Molecular Formula | C20H14Cl2F4N2O |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 2-amino-1-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]ethanone |
| SMILES | NCC(=O)n1ccc2cc(C=CC(c3cc(Cl)c(F)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H14Cl2F4N2O/c21-15-8-13(9-16(22)19(15)23)14(20(24,25)26)3-1-11-2-4-17-12(7-11)5-6-28(17)18(29)10-27/h1-9,14H,10,27H2 |
| InChIKey | QSLAGTHYJVVKFZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|