C21H13Cl2F4N2O3- — CID 154061370
N-[2-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]-2-oxoethyl]carbamate (PubChem CID 154061370) has the molecular formula C21H13Cl2F4N2O3- and a molecular weight of 488.24 g/mol. Its IUPAC name is N-[2-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]-2-oxoethyl]carbamate.
| Compound Name | N-[2-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 154061370 |
| Molecular Formula | C21H13Cl2F4N2O3- |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | N-[2-[5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]indol-1-yl]-2-oxoethyl]carbamate |
| SMILES | O=C([O-])NCC(=O)n1ccc2cc(C=CC(c3cc(Cl)c(F)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H14Cl2F4N2O3/c22-15-8-13(9-16(23)19(15)24)14(21(25,26)27)3-1-11-2-4-17-12(7-11)5-6-29(17)18(30)10-28-20(31)32/h1-9,14,28H,10H2,(H,31,32)/p-1 |
| InChIKey | IEJSBRTXLLZJLF-UHFFFAOYSA-M |
| XLogP | 5.02 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|