C21H18BrCl2F4N3O2 — CID 123763560
1-[[2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-ethyl-1-methylurea (PubChem CID 123763560) has the molecular formula C21H18BrCl2F4N3O2 and a molecular weight of 571.20 g/mol. Its IUPAC name is 1-[[2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-ethyl-1-methylurea.
| Compound Name | 1-[[2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-ethyl-1-methylurea |
|---|---|
| PubChem CID | 123763560 |
| Molecular Formula | C21H18BrCl2F4N3O2 |
| Molecular Weight | 571.20 g/mol |
| Exact Mass | 568.99 |
| IUPAC Name | 1-[[2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-ethyl-1-methylurea |
| SMILES | CCNC(=O)N(C)NC(=O)c1ccc(C=CC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C21H18BrCl2F4N3O2/c1-3-29-20(33)31(2)30-19(32)13-6-4-11(8-15(13)22)5-7-14(21(26,27)28)12-9-16(23)18(25)17(24)10-12/h4-10,14H,3H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | QQSYFPOZIGWEPX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.20 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|