C21H19Cl3F3N3O2 — CID 118887256
3-ethyl-1-methyl-1-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea (PubChem CID 118887256) has the molecular formula C21H19Cl3F3N3O2 and a molecular weight of 508.76 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea.
| Compound Name | 3-ethyl-1-methyl-1-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea |
|---|---|
| PubChem CID | 118887256 |
| Molecular Formula | C21H19Cl3F3N3O2 |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 3-ethyl-1-methyl-1-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea |
| SMILES | CCNC(=O)N(C)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19Cl3F3N3O2/c1-3-28-20(32)30(2)29-19(31)13-7-4-12(5-8-13)6-9-15(21(25,26)27)14-10-16(22)18(24)17(23)11-14/h4-11,15H,3H2,1-2H3,(H,28,32)(H,29,31)/b9-6+ |
| InChIKey | VFGWKEVNADHHKA-RMKNXTFCSA-N |
| XLogP | 6.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|