C24H20Cl3F6NO2 — CID 147679196
2,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)-4-[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide (PubChem CID 147679196) has the molecular formula C24H20Cl3F6NO2 and a molecular weight of 574.78 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)-4-[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide.
| Compound Name | 2,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)-4-[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide |
|---|---|
| PubChem CID | 147679196 |
| Molecular Formula | C24H20Cl3F6NO2 |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | 2,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)-4-[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide |
| SMILES | CC(C)(CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H20Cl3F6NO2/c1-22(2,21(36)34-12-23(28,29)30)11-19(35)14-6-3-13(4-7-14)5-8-16(24(31,32)33)15-9-17(25)20(27)18(26)10-15/h3-10,16H,11-12H2,1-2H3,(H,34,36)/b8-5+ |
| InChIKey | GOTSKYYEKRSZDA-VMPITWQZSA-N |
| XLogP | 8.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|