C22H18Cl3F6NO3S — CID 130236564
N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130236564) has the molecular formula C22H18Cl3F6NO3S and a molecular weight of 596.80 g/mol. Its IUPAC name is N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130236564 |
| Molecular Formula | C22H18Cl3F6NO3S |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 595.00 |
| IUPAC Name | N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CC(CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18Cl3F6NO3S/c1-12(10-36(34,35)11-21(26,27)28)32-20(33)14-5-2-13(3-6-14)4-7-16(22(29,30)31)15-8-17(23)19(25)18(24)9-15/h2-9,12,16H,10-11H2,1H3,(H,32,33)/b7-4+ |
| InChIKey | JBJQCFFKKJSHNG-QPJJXVBHSA-N |
| XLogP | 7.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.80 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|