C23H20Cl3F6NOS — CID 130236566
2-methyl-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130236566) has the molecular formula C23H20Cl3F6NOS and a molecular weight of 578.83 g/mol. Its IUPAC name is 2-methyl-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-methyl-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130236566 |
| Molecular Formula | C23H20Cl3F6NOS |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | 2-methyl-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)N[C@H](C)CSCC(F)(F)F |
| InChI | InChI=1S/C23H20Cl3F6NOS/c1-12-7-14(3-5-16(12)21(34)33-13(2)10-35-11-22(27,28)29)4-6-17(23(30,31)32)15-8-18(24)20(26)19(25)9-15/h3-9,13,17H,10-11H2,1-2H3,(H,33,34)/b6-4+/t13-,17?/m1/s1 |
| InChIKey | ZFVXXMAYUXMBLQ-GQIUSPPNSA-N |
| XLogP | 8.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|